C26H32N6O4 — CID 67661253
3-(pyridin-2-ylamino)propyl (2S)-2-(cyclohexanecarbonylamino)-3-(1H-indazole-5-carbonylamino)propanoate (PubChem CID 67661253) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-(pyridin-2-ylamino)propyl (2S)-2-(cyclohexanecarbonylamino)-3-(1H-indazole-5-carbonylamino)propanoate.
| Compound Name | 3-(pyridin-2-ylamino)propyl (2S)-2-(cyclohexanecarbonylamino)-3-(1H-indazole-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 67661253 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 3-(pyridin-2-ylamino)propyl (2S)-2-(cyclohexanecarbonylamino)-3-(1H-indazole-5-carbonylamino)propanoate |
| SMILES | O=C(NC[C@H](NC(=O)C1CCCCC1)C(=O)OCCCNc1ccccn1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C26H32N6O4/c33-24(19-10-11-21-20(15-19)16-30-32-21)29-17-22(31-25(34)18-7-2-1-3-8-18)26(35)36-14-6-13-28-23-9-4-5-12-27-23/h4-5,9-12,15-16,18,22H,1-3,6-8,13-14,17H2,(H,27,28)(H,29,33)(H,30,32)(H,31,34)/t22-/m0/s1 |
| InChIKey | RCKPZYYTANARAW-QFIPXVFZSA-N |
| XLogP | 2.80 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|