C28H28N6O4 — CID 70245971
2-(2-phenylprop-2-enoylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid (PubChem CID 70245971) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-(2-phenylprop-2-enoylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 2-(2-phenylprop-2-enoylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70245971 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2-(2-phenylprop-2-enoylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid |
| SMILES | C=C(C(=O)NC(CNC(=O)c1ccc2c(cnn2CCCNc2ccccn2)c1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H28N6O4/c1-19(20-8-3-2-4-9-20)26(35)33-23(28(37)38)18-31-27(36)21-11-12-24-22(16-21)17-32-34(24)15-7-14-30-25-10-5-6-13-29-25/h2-6,8-13,16-17,23H,1,7,14-15,18H2,(H,29,30)(H,31,36)(H,33,35)(H,37,38) |
| InChIKey | SBDBUXFWNGEYPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|