C28H35N7O5S — CID 142064707
3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(4-pentylphenyl)sulfonylamino]propanoic acid (PubChem CID 142064707) has the molecular formula C28H35N7O5S and a molecular weight of 581.70 g/mol. Its IUPAC name is 3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(4-pentylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(4-pentylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 142064707 |
| Molecular Formula | C28H35N7O5S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(4-pentylphenyl)sulfonylamino]propanoic acid |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC(CNC(=O)c2ccc3c(cnn3CCCNc3ncc[nH]3)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H35N7O5S/c1-2-3-4-6-20-7-10-23(11-8-20)41(39,40)34-24(27(37)38)19-32-26(36)21-9-12-25-22(17-21)18-33-35(25)16-5-13-29-28-30-14-15-31-28/h7-12,14-15,17-18,24,34H,2-6,13,16,19H2,1H3,(H,32,36)(H,37,38)(H2,29,30,31) |
| InChIKey | FOMFYWTWCWBAFM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|