C19H20F3N7O4 — CID 59978259
(2S)-3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 59978259) has the molecular formula C19H20F3N7O4 and a molecular weight of 467.41 g/mol. Its IUPAC name is (2S)-3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | (2S)-3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 59978259 |
| Molecular Formula | C19H20F3N7O4 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (2S)-3-[[1-[3-(1H-imidazol-2-ylamino)propyl]indazole-5-carbonyl]amino]-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | O=C(NC[C@H](NC(=O)C(F)(F)F)C(=O)O)c1ccc2c(cnn2CCCNc2ncc[nH]2)c1 |
| InChI | InChI=1S/C19H20F3N7O4/c20-19(21,22)17(33)28-13(16(31)32)10-26-15(30)11-2-3-14-12(8-11)9-27-29(14)7-1-4-23-18-24-5-6-25-18/h2-3,5-6,8-9,13H,1,4,7,10H2,(H,26,30)(H,28,33)(H,31,32)(H2,23,24,25)/t13-/m0/s1 |
| InChIKey | MNLHVFKEWUNFLS-ZDUSSCGKSA-N |
| XLogP | 1.12 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|