C26H32N6O4 — CID 18660411
(2S)-2-(cyclohexanecarbonylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid (PubChem CID 18660411) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is (2S)-2-(cyclohexanecarbonylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-(cyclohexanecarbonylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18660411 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (2S)-2-(cyclohexanecarbonylamino)-3-[[1-[3-(pyridin-2-ylamino)propyl]indazole-5-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC[C@H](NC(=O)C1CCCCC1)C(=O)O)c1ccc2c(cnn2CCCNc2ccccn2)c1 |
| InChI | InChI=1S/C26H32N6O4/c33-24(29-17-21(26(35)36)31-25(34)18-7-2-1-3-8-18)19-10-11-22-20(15-19)16-30-32(22)14-6-13-28-23-9-4-5-12-27-23/h4-5,9-12,15-16,18,21H,1-3,6-8,13-14,17H2,(H,27,28)(H,29,33)(H,31,34)(H,35,36)/t21-/m0/s1 |
| InChIKey | JBKBHJUMIKYNCB-NRFANRHFSA-N |
| XLogP | 2.81 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|