C45H43N7O5 — CID 59974060
methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate (PubChem CID 59974060) has the molecular formula C45H43N7O5 and a molecular weight of 761.88 g/mol. Its IUPAC name is methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 59974060 |
| Molecular Formula | C45H43N7O5 |
| Molecular Weight | 761.88 g/mol |
| Exact Mass | 761.33 |
| IUPAC Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CNC(=O)c1ccc2c(cnn2CCCNc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H43N7O5/c1-56-42(54)39(50-44(55)57-32-33-15-6-2-7-16-33)31-48-41(53)34-23-24-40-35(29-34)30-49-52(40)27-14-25-46-43-47-26-28-51(43)45(36-17-8-3-9-18-36,37-19-10-4-11-20-37)38-21-12-5-13-22-38/h2-13,15-24,26,28-30,39H,14,25,27,31-32H2,1H3,(H,46,47)(H,48,53)(H,50,55)/t39-/m0/s1 |
| InChIKey | BXDQWXYEBSDTPS-KDXMTYKHSA-N |
| XLogP | 6.77 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|