C41H44N6O5 — CID 22598957
7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carboxylic acid (PubChem CID 22598957) has the molecular formula C41H44N6O5 and a molecular weight of 700.84 g/mol. Its IUPAC name is 7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carboxylic acid.
| Compound Name | 7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22598957 |
| Molecular Formula | C41H44N6O5 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.34 |
| IUPAC Name | 7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCOc1cc(C(=O)O)cc2cnn(CCCNc3nccn3C(c3ccccc3)(c3ccccc3)c3ccccc3)c12 |
| InChI | InChI=1S/C41H44N6O5/c1-40(2,3)52-39(50)44-22-14-26-51-35-28-30(37(48)49)27-31-29-45-47(36(31)35)24-13-21-42-38-43-23-25-46(38)41(32-15-7-4-8-16-32,33-17-9-5-10-18-33)34-19-11-6-12-20-34/h4-12,15-20,23,25,27-29H,13-14,21-22,24,26H2,1-3H3,(H,42,43)(H,44,50)(H,48,49) |
| InChIKey | OGIUPQJCXOFBTL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|