C20H25N3O6 — CID 122445440
3-[[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-6-oxopyridazin-1-yl]methyl]benzoic acid (PubChem CID 122445440) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-6-oxopyridazin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-6-oxopyridazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122445440 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-[[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-6-oxopyridazin-1-yl]methyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(=O)n(Cc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C20H25N3O6/c1-20(2,3)29-19(27)21-10-5-11-28-16-8-9-17(24)23(22-16)13-14-6-4-7-15(12-14)18(25)26/h4,6-9,12H,5,10-11,13H2,1-3H3,(H,21,27)(H,25,26) |
| InChIKey | SQTBEYRUIUCPEL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|