C18H24N2O6 — CID 67054465
3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-4-(prop-2-enoylamino)benzoic acid (PubChem CID 67054465) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-4-(prop-2-enoylamino)benzoic acid.
| Compound Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-4-(prop-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 67054465 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-4-(prop-2-enoylamino)benzoic acid |
| SMILES | C=CC(=O)Nc1ccc(C(=O)O)cc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O6/c1-5-15(21)20-13-8-7-12(16(22)23)11-14(13)25-10-6-9-19-17(24)26-18(2,3)4/h5,7-8,11H,1,6,9-10H2,2-4H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | UIZLNETUQOHZIW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|