C18H26N2O10 — CID 89017081
4-[3-(dihydroxyamino)oxypropoxy]-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]benzoic acid (PubChem CID 89017081) has the molecular formula C18H26N2O10 and a molecular weight of 430.41 g/mol. Its IUPAC name is 4-[3-(dihydroxyamino)oxypropoxy]-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]benzoic acid.
| Compound Name | 4-[3-(dihydroxyamino)oxypropoxy]-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]benzoic acid |
|---|---|
| PubChem CID | 89017081 |
| Molecular Formula | C18H26N2O10 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[3-(dihydroxyamino)oxypropoxy]-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Oc1cc(C(=O)O)ccc1OCCCON(O)O |
| InChI | InChI=1S/C18H26N2O10/c1-18(2,3)30-17(24)19-8-7-15(21)29-14-11-12(16(22)23)5-6-13(14)27-9-4-10-28-20(25)26/h5-6,11,25-26H,4,7-10H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | AMKXNFXCKZGGPJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|