C24H36N2O11 — CID 89017048
[2-[3-(dihydroxyamino)oxypropoxy]-5-formylphenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-2-yloxy)butanoate (PubChem CID 89017048) has the molecular formula C24H36N2O11 and a molecular weight of 528.56 g/mol. Its IUPAC name is [2-[3-(dihydroxyamino)oxypropoxy]-5-formylphenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-2-yloxy)butanoate.
| Compound Name | [2-[3-(dihydroxyamino)oxypropoxy]-5-formylphenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-2-yloxy)butanoate |
|---|---|
| PubChem CID | 89017048 |
| Molecular Formula | C24H36N2O11 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | [2-[3-(dihydroxyamino)oxypropoxy]-5-formylphenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-2-yloxy)butanoate |
| SMILES | CC(OC1CCCCO1)C(NC(=O)OC(C)(C)C)C(=O)Oc1cc(C=O)ccc1OCCCON(O)O |
| InChI | InChI=1S/C24H36N2O11/c1-16(35-20-8-5-6-11-33-20)21(25-23(29)37-24(2,3)4)22(28)36-19-14-17(15-27)9-10-18(19)32-12-7-13-34-26(30)31/h9-10,14-16,20-21,30-31H,5-8,11-13H2,1-4H3,(H,25,29) |
| InChIKey | FYSVNVLYHKDZAX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|