C39H63NO10 — CID 10941543
bis[8-(oxan-2-yloxy)octyl] 5-[(2-methylpropan-2-yl)oxycarbonylamino]benzene-1,3-dicarboxylate (PubChem CID 10941543) has the molecular formula C39H63NO10 and a molecular weight of 705.93 g/mol. Its IUPAC name is bis[8-(oxan-2-yloxy)octyl] 5-[(2-methylpropan-2-yl)oxycarbonylamino]benzene-1,3-dicarboxylate.
| Compound Name | bis[8-(oxan-2-yloxy)octyl] 5-[(2-methylpropan-2-yl)oxycarbonylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10941543 |
| Molecular Formula | C39H63NO10 |
| Molecular Weight | 705.93 g/mol |
| Exact Mass | 705.45 |
| IUPAC Name | bis[8-(oxan-2-yloxy)octyl] 5-[(2-methylpropan-2-yl)oxycarbonylamino]benzene-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(=O)OCCCCCCCCOC2CCCCO2)cc(C(=O)OCCCCCCCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C39H63NO10/c1-39(2,3)50-38(43)40-33-29-31(36(41)48-26-16-10-6-4-8-14-22-44-34-20-12-18-24-46-34)28-32(30-33)37(42)49-27-17-11-7-5-9-15-23-45-35-21-13-19-25-47-35/h28-30,34-35H,4-27H2,1-3H3,(H,40,43) |
| InChIKey | RKTFELGXWUGXKY-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.93 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|