C18H27NO5 — CID 131738688
tert-butyl N-[3-methoxy-5-(oxan-2-ylmethoxy)phenyl]carbamate (PubChem CID 131738688) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[3-methoxy-5-(oxan-2-ylmethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-methoxy-5-(oxan-2-ylmethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 131738688 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | tert-butyl N-[3-methoxy-5-(oxan-2-ylmethoxy)phenyl]carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)cc(OCC2CCCCO2)c1 |
| InChI | InChI=1S/C18H27NO5/c1-18(2,3)24-17(20)19-13-9-15(21-4)11-16(10-13)23-12-14-7-5-6-8-22-14/h9-11,14H,5-8,12H2,1-4H3,(H,19,20) |
| InChIKey | ROUSYBIWMLDODR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |