C18H26N2O4 — CID 31400679
tert-butyl N-[4-[2-[(2S)-oxolan-2-yl]ethylcarbamoyl]phenyl]carbamate (PubChem CID 31400679) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[(2S)-oxolan-2-yl]ethylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[(2S)-oxolan-2-yl]ethylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 31400679 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl N-[4-[2-[(2S)-oxolan-2-yl]ethylcarbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NCC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-18(2,3)24-17(22)20-14-8-6-13(7-9-14)16(21)19-11-10-15-5-4-12-23-15/h6-9,15H,4-5,10-12H2,1-3H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | XPMDBEKEKPDUJW-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |