About [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate
[(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (PubChem CID 95568766) has the molecular formula C17H23NO6
and a molecular weight of 337.37 g/mol. Its IUPAC name is [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate.
Molecular Properties
| Compound Name | [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| PubChem CID | 95568766 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)OC[C@@H]2CCOCO2)c1 |
| InChI | InChI=1S/C17H23NO6/c1-17(2,3)24-16(20)18-13-6-4-5-12(9-13)15(19)22-10-14-7-8-21-11-23-14/h4-6,9,14H,7-8,10-11H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | WZECYKWBMIFOOR-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate?
The IUPAC name of [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CID 95568766) is [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate.
What is the SMILES notation for [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate?
The canonical SMILES for [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate is CC(C)(C)OC(=O)Nc1cccc(C(=O)OC[C@@H]2CCOCO2)c1.
What is the InChIKey of [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate?
The InChIKey is WZECYKWBMIFOOR-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H23NO6/c1-17(2,3)24-16(20)18-13-6-4-5-12(9-13)15(19)22-10-14-7-8-21-11-23-14/h4-6,9,14H,7-8,10-11H2,1-3H3,(H,18,20)/t14-/m0/s1.
What are the key properties of [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate?
[(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate has a molecular weight of 337.37 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-1,3-dioxan-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate is sourced from PubChem (CID 95568766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).