C21H38O6S — CID 142526772
tert-butyl 4-[6-(oxan-2-yloxy)hexyl]-1,1-dioxothiane-4-carboxylate (PubChem CID 142526772) has the molecular formula C21H38O6S and a molecular weight of 418.60 g/mol. Its IUPAC name is tert-butyl 4-[6-(oxan-2-yloxy)hexyl]-1,1-dioxothiane-4-carboxylate.
| Compound Name | tert-butyl 4-[6-(oxan-2-yloxy)hexyl]-1,1-dioxothiane-4-carboxylate |
|---|---|
| PubChem CID | 142526772 |
| Molecular Formula | C21H38O6S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | tert-butyl 4-[6-(oxan-2-yloxy)hexyl]-1,1-dioxothiane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(CCCCCCOC2CCCCO2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C21H38O6S/c1-20(2,3)27-19(22)21(12-16-28(23,24)17-13-21)11-7-4-5-8-14-25-18-10-6-9-15-26-18/h18H,4-17H2,1-3H3 |
| InChIKey | XHXPIBUWHLFAMT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|