C13H24O4S — CID 130272215
tert-butyl 1,1-dioxo-4-propylthiane-4-carboxylate (PubChem CID 130272215) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is tert-butyl 1,1-dioxo-4-propylthiane-4-carboxylate.
| Compound Name | tert-butyl 1,1-dioxo-4-propylthiane-4-carboxylate |
|---|---|
| PubChem CID | 130272215 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | tert-butyl 1,1-dioxo-4-propylthiane-4-carboxylate |
| SMILES | CCCC1(C(=O)OC(C)(C)C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H24O4S/c1-5-6-13(11(14)17-12(2,3)4)7-9-18(15,16)10-8-13/h5-10H2,1-4H3 |
| InChIKey | UCKGPHPNLFTVDP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |