C12H22O3 — CID 154791918
tert-butyl 1-(3-methoxypropyl)cyclopropane-1-carboxylate (PubChem CID 154791918) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is tert-butyl 1-(3-methoxypropyl)cyclopropane-1-carboxylate.
| Compound Name | tert-butyl 1-(3-methoxypropyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 154791918 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | tert-butyl 1-(3-methoxypropyl)cyclopropane-1-carboxylate |
| SMILES | COCCCC1(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)15-10(13)12(7-8-12)6-5-9-14-4/h5-9H2,1-4H3 |
| InChIKey | VQPHFMPUARNFNS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|