C16H29BrO2 — CID 166525029
tert-butyl 1-(7-bromoheptyl)cyclobutane-1-carboxylate (PubChem CID 166525029) has the molecular formula C16H29BrO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is tert-butyl 1-(7-bromoheptyl)cyclobutane-1-carboxylate.
| Compound Name | tert-butyl 1-(7-bromoheptyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166525029 |
| Molecular Formula | C16H29BrO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | tert-butyl 1-(7-bromoheptyl)cyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(CCCCCCCBr)CCC1 |
| InChI | InChI=1S/C16H29BrO2/c1-15(2,3)19-14(18)16(11-9-12-16)10-7-5-4-6-8-13-17/h4-13H2,1-3H3 |
| InChIKey | RXDDSNPHANDTCN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|