C16H28Br2O3 — CID 159278524
tert-butyl 1-acetylcyclopentane-1-carboxylate;1,4-dibromobutane (PubChem CID 159278524) has the molecular formula C16H28Br2O3 and a molecular weight of 428.21 g/mol. Its IUPAC name is tert-butyl 1-acetylcyclopentane-1-carboxylate;1,4-dibromobutane.
| Compound Name | tert-butyl 1-acetylcyclopentane-1-carboxylate;1,4-dibromobutane |
|---|---|
| PubChem CID | 159278524 |
| Molecular Formula | C16H28Br2O3 |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | tert-butyl 1-acetylcyclopentane-1-carboxylate;1,4-dibromobutane |
| SMILES | BrCCCCBr.CC(=O)C1(C(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C12H20O3.C4H8Br2/c1-9(13)12(7-5-6-8-12)10(14)15-11(2,3)4;5-3-1-2-4-6/h5-8H2,1-4H3;1-4H2 |
| InChIKey | KYPSHVDXWIPTLS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|