C10H15ClO4 — CID 155592238
1-O'-tert-butyl 1-O-(chloromethyl) cyclopropane-1,1-dicarboxylate (PubChem CID 155592238) has the molecular formula C10H15ClO4 and a molecular weight of 234.68 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-(chloromethyl) cyclopropane-1,1-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-(chloromethyl) cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 155592238 |
| Molecular Formula | C10H15ClO4 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-O'-tert-butyl 1-O-(chloromethyl) cyclopropane-1,1-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OCCl)CC1 |
| InChI | InChI=1S/C10H15ClO4/c1-9(2,3)15-8(13)10(4-5-10)7(12)14-6-11/h4-6H2,1-3H3 |
| InChIKey | WBJNLJXNKSZISX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|