C16H20ClNO4 — CID 165438952
chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-dihydroindene-2-carboxylate (PubChem CID 165438952) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-dihydroindene-2-carboxylate.
| Compound Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 165438952 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-dihydroindene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)OCCl)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H20ClNO4/c1-15(2,3)22-14(20)18-16(13(19)21-10-17)8-11-6-4-5-7-12(11)9-16/h4-7H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | JCCMLICHPCBIEQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|