C26H32N2O5 — CID 11259520
ethyl 9-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-9-carboxylate (PubChem CID 11259520) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 9-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-9-carboxylate.
| Compound Name | ethyl 9-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-9-carboxylate |
|---|---|
| PubChem CID | 11259520 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl 9-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-9-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)[C@H](C)NC(=O)OC(C)(C)C)Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C26H32N2O5/c1-6-32-23(30)26(28-22(29)17(2)27-24(31)33-25(3,4)5)15-18-11-7-9-13-20(18)21-14-10-8-12-19(21)16-26/h7-14,17H,6,15-16H2,1-5H3,(H,27,31)(H,28,29)/t17-/m0/s1 |
| InChIKey | NZLJSXRDEYSDBU-KRWDZBQOSA-N |
| XLogP | 3.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |