C21H31N3O6 — CID 137378711
hydroxymethyl 1-benzyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]pyrrolidine-3-carboxylate (PubChem CID 137378711) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is hydroxymethyl 1-benzyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]pyrrolidine-3-carboxylate.
| Compound Name | hydroxymethyl 1-benzyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 137378711 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | hydroxymethyl 1-benzyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]pyrrolidine-3-carboxylate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NC1(C(=O)OCO)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H31N3O6/c1-15(22-19(28)30-20(2,3)4)17(26)23-21(18(27)29-14-25)10-11-24(13-21)12-16-8-6-5-7-9-16/h5-9,15,25H,10-14H2,1-4H3,(H,22,28)(H,23,26) |
| InChIKey | HGNSWATZGKEPOP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|