C24H34N4O3 — CID 69415751
tert-butyl N-[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)carbamoyl]cyclohexyl]carbamate (PubChem CID 69415751) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl N-[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69415751 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl N-[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)NC2(C#N)CCN(Cc3ccccc3)C2)CCCCC1 |
| InChI | InChI=1S/C24H34N4O3/c1-22(2,3)31-21(30)27-24(12-8-5-9-13-24)20(29)26-23(17-25)14-15-28(18-23)16-19-10-6-4-7-11-19/h4,6-7,10-11H,5,8-9,12-16,18H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | PIQYFEXLGGJICH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |