C20H28N4O2 — CID 22063375
N'-(1-benzyl-4-cyanopiperidin-4-yl)-2,2-dimethylpentanediamide (PubChem CID 22063375) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N'-(1-benzyl-4-cyanopiperidin-4-yl)-2,2-dimethylpentanediamide.
| Compound Name | N'-(1-benzyl-4-cyanopiperidin-4-yl)-2,2-dimethylpentanediamide |
|---|---|
| PubChem CID | 22063375 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N'-(1-benzyl-4-cyanopiperidin-4-yl)-2,2-dimethylpentanediamide |
| SMILES | CC(C)(CCC(=O)NC1(C#N)CCN(Cc2ccccc2)CC1)C(N)=O |
| InChI | InChI=1S/C20H28N4O2/c1-19(2,18(22)26)9-8-17(25)23-20(15-21)10-12-24(13-11-20)14-16-6-4-3-5-7-16/h3-7H,8-14H2,1-2H3,(H2,22,26)(H,23,25) |
| InChIKey | GJLKIWDDGYGIHM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |