C28H42N6O4 — CID 10186586
ethyl N-[N-[1-[(1-benzyl-4-cyanopiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 10186586) has the molecular formula C28H42N6O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is ethyl N-[N-[1-[(1-benzyl-4-cyanopiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[1-[(1-benzyl-4-cyanopiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 10186586 |
| Molecular Formula | C28H42N6O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | ethyl N-[N-[1-[(1-benzyl-4-cyanopiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\C(CC(C)(C)C)C(=O)NC1(C#N)CCN(Cc2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C28H42N6O4/c1-5-38-26(36)31-25(34-15-17-37-18-16-34)30-23(19-27(2,3)4)24(35)32-28(21-29)11-13-33(14-12-28)20-22-9-7-6-8-10-22/h6-10,23H,5,11-20H2,1-4H3,(H,32,35)(H,30,31,36) |
| InChIKey | VAVQUUFNYQBQEW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|