C22H39N7O3 — CID 90852865
2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide (PubChem CID 90852865) has the molecular formula C22H39N7O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide.
| Compound Name | 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 90852865 |
| Molecular Formula | C22H39N7O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-(4-cyano-1-propylpiperidin-4-yl)-4,4-dimethylpentanamide |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC(C)(C)C)/N=C(\NC(N)=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H39N7O3/c1-5-8-28-9-6-22(16-23,7-10-28)27-18(30)17(15-21(2,3)4)25-20(26-19(24)31)29-11-13-32-14-12-29/h17H,5-15H2,1-4H3,(H,27,30)(H3,24,25,26,31) |
| InChIKey | UPBWYIYHQFCSQQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|