C22H40N6O4S — CID 10116950
N-(4-cyano-1-propylpiperidin-4-yl)-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide (PubChem CID 10116950) has the molecular formula C22H40N6O4S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-(4-cyano-1-propylpiperidin-4-yl)-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide.
| Compound Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 10116950 |
| Molecular Formula | C22H40N6O4S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC(C)(C)C)/N=C(\NS(C)(=O)=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H40N6O4S/c1-6-9-27-10-7-22(17-23,8-11-27)25-19(29)18(16-21(2,3)4)24-20(26-33(5,30)31)28-12-14-32-15-13-28/h18H,6-16H2,1-5H3,(H,24,26)(H,25,29) |
| InChIKey | HORWGRRUYCJULB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|