C26H40N6O4S — CID 91523235
N-[3-cyano-1-(2-phenylethyl)pyrrolidin-3-yl]-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide (PubChem CID 91523235) has the molecular formula C26H40N6O4S and a molecular weight of 532.71 g/mol. Its IUPAC name is N-[3-cyano-1-(2-phenylethyl)pyrrolidin-3-yl]-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide.
| Compound Name | N-[3-cyano-1-(2-phenylethyl)pyrrolidin-3-yl]-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 91523235 |
| Molecular Formula | C26H40N6O4S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | N-[3-cyano-1-(2-phenylethyl)pyrrolidin-3-yl]-2-[[methanesulfonamido(morpholin-4-yl)methylidene]amino]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(/N=C(\NS(C)(=O)=O)N1CCOCC1)C(=O)NC1(C#N)CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C26H40N6O4S/c1-25(2,3)18-22(28-24(30-37(4,34)35)32-14-16-36-17-15-32)23(33)29-26(19-27)11-13-31(20-26)12-10-21-8-6-5-7-9-21/h5-9,22H,10-18,20H2,1-4H3,(H,28,30)(H,29,33) |
| InChIKey | QGDIDZSBPZSYBO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|