C27H44N6O4 — CID 142123408
ethyl N-[N-[(2S)-1-[(4-amino-1-benzylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 142123408) has the molecular formula C27H44N6O4 and a molecular weight of 516.69 g/mol. Its IUPAC name is ethyl N-[N-[(2S)-1-[(4-amino-1-benzylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[(2S)-1-[(4-amino-1-benzylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 142123408 |
| Molecular Formula | C27H44N6O4 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | ethyl N-[N-[(2S)-1-[(4-amino-1-benzylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\[C@@H](CC(C)(C)C)C(=O)NC1(N)CCN(Cc2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C27H44N6O4/c1-5-37-25(35)30-24(33-15-17-36-18-16-33)29-22(19-26(2,3)4)23(34)31-27(28)11-13-32(14-12-27)20-21-9-7-6-8-10-21/h6-10,22H,5,11-20,28H2,1-4H3,(H,31,34)(H,29,30,35)/t22-/m0/s1 |
| InChIKey | FQXZQQIUGHOEDJ-QFIPXVFZSA-N |
| XLogP | 2.29 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|