C30H46N6O5 — CID 154428020
2-methoxyethyl N-[N-[1-[(4-cyanopiperidin-4-yl)-(1-phenylethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 154428020) has the molecular formula C30H46N6O5 and a molecular weight of 570.74 g/mol. Its IUPAC name is 2-methoxyethyl N-[N-[1-[(4-cyanopiperidin-4-yl)-(1-phenylethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | 2-methoxyethyl N-[N-[1-[(4-cyanopiperidin-4-yl)-(1-phenylethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 154428020 |
| Molecular Formula | C30H46N6O5 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | 2-methoxyethyl N-[N-[1-[(4-cyanopiperidin-4-yl)-(1-phenylethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | COCCOC(=O)N/C(=N\C(CC(C)(C)C)C(=O)N(C(C)c1ccccc1)C1(C#N)CCNCC1)N1CCOCC1 |
| InChI | InChI=1S/C30H46N6O5/c1-23(24-9-7-6-8-10-24)36(30(22-31)11-13-32-14-12-30)26(37)25(21-29(2,3)4)33-27(35-15-17-40-18-16-35)34-28(38)41-20-19-39-5/h6-10,23,25,32H,11-21H2,1-5H3,(H,33,34,38) |
| InChIKey | CALAJYUNCVXAIV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|