C21H24N2O4 — CID 54336575
2-morpholin-4-ylethyl N-(2,2-diphenylacetyl)carbamate (PubChem CID 54336575) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N-(2,2-diphenylacetyl)carbamate.
| Compound Name | 2-morpholin-4-ylethyl N-(2,2-diphenylacetyl)carbamate |
|---|---|
| PubChem CID | 54336575 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-morpholin-4-ylethyl N-(2,2-diphenylacetyl)carbamate |
| SMILES | O=C(NC(=O)C(c1ccccc1)c1ccccc1)OCCN1CCOCC1 |
| InChI | InChI=1S/C21H24N2O4/c24-20(22-21(25)27-16-13-23-11-14-26-15-12-23)19(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,19H,11-16H2,(H,22,24,25) |
| InChIKey | TVWWHFOVAUDGHB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |