C14H20N2O4 — CID 3087022
2-morpholin-4-ylethyl N-(2-methoxyphenyl)carbamate (PubChem CID 3087022) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N-(2-methoxyphenyl)carbamate.
| Compound Name | 2-morpholin-4-ylethyl N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3087022 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-morpholin-4-ylethyl N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1NC(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C14H20N2O4/c1-18-13-5-3-2-4-12(13)15-14(17)20-11-8-16-6-9-19-10-7-16/h2-5H,6-11H2,1H3,(H,15,17) |
| InChIKey | MVEFAOSRCNUAHX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |