About 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate
2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate (PubChem CID 113360064) has the molecular formula C12H16ClNO4
and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate.
Molecular Properties
| Compound Name | 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate |
| PubChem CID | 113360064 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1NC(=O)OCCOCCCl |
| InChI | InChI=1S/C12H16ClNO4/c1-16-11-5-3-2-4-10(11)14-12(15)18-9-8-17-7-6-13/h2-5H,6-9H2,1H3,(H,14,15) |
| InChIKey | CMSWVUDDYIQWTA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate?
The IUPAC name of 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate (CID 113360064) is 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate.
What is the SMILES notation for 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate?
The canonical SMILES for 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate is COc1ccccc1NC(=O)OCCOCCCl.
What is the InChIKey of 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate?
The InChIKey is CMSWVUDDYIQWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO4/c1-16-11-5-3-2-4-10(11)14-12(15)18-9-8-17-7-6-13/h2-5H,6-9H2,1H3,(H,14,15).
What are the key properties of 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate?
2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate has a molecular weight of 273.72 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethoxy)ethyl N-(2-methoxyphenyl)carbamate is sourced from PubChem (CID 113360064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).