C11H12ClF2NO3 — CID 113360062
2-(2-chloroethoxy)ethyl N-(2,4-difluorophenyl)carbamate (PubChem CID 113360062) has the molecular formula C11H12ClF2NO3 and a molecular weight of 279.67 g/mol. Its IUPAC name is 2-(2-chloroethoxy)ethyl N-(2,4-difluorophenyl)carbamate.
| Compound Name | 2-(2-chloroethoxy)ethyl N-(2,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 113360062 |
| Molecular Formula | C11H12ClF2NO3 |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(2-chloroethoxy)ethyl N-(2,4-difluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1F)OCCOCCCl |
| InChI | InChI=1S/C11H12ClF2NO3/c12-3-4-17-5-6-18-11(16)15-10-2-1-8(13)7-9(10)14/h1-2,7H,3-6H2,(H,15,16) |
| InChIKey | QVMCQEWSLQLOBQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|