C19H17F2NO6 — CID 69005739
2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]phenyl]methyl]propanedioic acid (PubChem CID 69005739) has the molecular formula C19H17F2NO6 and a molecular weight of 393.34 g/mol. Its IUPAC name is 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 69005739 |
| Molecular Formula | C19H17F2NO6 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]phenyl]methyl]propanedioic acid |
| SMILES | O=C(Nc1ccc(F)cc1F)OCCc1cccc(CC(C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C19H17F2NO6/c20-13-4-5-16(15(21)10-13)22-19(27)28-7-6-11-2-1-3-12(8-11)9-14(17(23)24)18(25)26/h1-5,8,10,14H,6-7,9H2,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | WJLXQZWQMWGYPP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|