C20H19F2NO7 — CID 69008246
2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]propanedioic acid (PubChem CID 69008246) has the molecular formula C20H19F2NO7 and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]propanedioic acid.
| Compound Name | 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 69008246 |
| Molecular Formula | C20H19F2NO7 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]propanedioic acid |
| SMILES | COc1ccc(CC(C(=O)O)C(=O)O)cc1CCOC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F2NO7/c1-29-17-5-2-11(9-14(18(24)25)19(26)27)8-12(17)6-7-30-20(28)23-16-4-3-13(21)10-15(16)22/h2-5,8,10,14H,6-7,9H2,1H3,(H,23,28)(H,24,25)(H,26,27) |
| InChIKey | BTYUDEQTZWCRHV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|