C19H17F2NO7 — CID 69005223
2-[[3-[(2,4-difluorophenyl)carbamoyloxymethyl]-4-methoxyphenyl]methyl]propanedioic acid (PubChem CID 69005223) has the molecular formula C19H17F2NO7 and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[[3-[(2,4-difluorophenyl)carbamoyloxymethyl]-4-methoxyphenyl]methyl]propanedioic acid.
| Compound Name | 2-[[3-[(2,4-difluorophenyl)carbamoyloxymethyl]-4-methoxyphenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 69005223 |
| Molecular Formula | C19H17F2NO7 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[[3-[(2,4-difluorophenyl)carbamoyloxymethyl]-4-methoxyphenyl]methyl]propanedioic acid |
| SMILES | COc1ccc(CC(C(=O)O)C(=O)O)cc1COC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H17F2NO7/c1-28-16-5-2-10(7-13(17(23)24)18(25)26)6-11(16)9-29-19(27)22-15-4-3-12(20)8-14(15)21/h2-6,8,13H,7,9H2,1H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | WFEWFVGOQWNKLP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|