C22H25F2NO7 — CID 142193358
methyl 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]-3-hydroxy-3-methoxypropanoate (PubChem CID 142193358) has the molecular formula C22H25F2NO7 and a molecular weight of 453.44 g/mol. Its IUPAC name is methyl 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]-3-hydroxy-3-methoxypropanoate.
| Compound Name | methyl 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]-3-hydroxy-3-methoxypropanoate |
|---|---|
| PubChem CID | 142193358 |
| Molecular Formula | C22H25F2NO7 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 2-[[3-[2-[(2,4-difluorophenyl)carbamoyloxy]ethyl]-4-methoxyphenyl]methyl]-3-hydroxy-3-methoxypropanoate |
| SMILES | COC(=O)C(Cc1ccc(OC)c(CCOC(=O)Nc2ccc(F)cc2F)c1)C(O)OC |
| InChI | InChI=1S/C22H25F2NO7/c1-29-19-7-4-13(11-16(20(26)30-2)21(27)31-3)10-14(19)8-9-32-22(28)25-18-6-5-15(23)12-17(18)24/h4-7,10,12,16,20,26H,8-9,11H2,1-3H3,(H,25,28) |
| InChIKey | SNUGTVCYFSEAFO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|