C11H12F2N2O4 — CID 103878987
methyl 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanoate (PubChem CID 103878987) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is methyl 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103878987 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl 3-[(2,4-difluorophenyl)carbamoylamino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O4/c1-19-10(17)9(16)5-14-11(18)15-8-3-2-6(12)4-7(8)13/h2-4,9,16H,5H2,1H3,(H2,14,15,18) |
| InChIKey | JSMFSCJOJDETKO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |