C13H18F2N2O2 — CID 46457511
1-(2,4-difluorophenyl)-3-(3-propan-2-yloxypropyl)urea (PubChem CID 46457511) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 46457511 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-propan-2-yloxypropyl)urea |
| SMILES | CC(C)OCCCNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-9(2)19-7-3-6-16-13(18)17-12-5-4-10(14)8-11(12)15/h4-5,8-9H,3,6-7H2,1-2H3,(H2,16,17,18) |
| InChIKey | BNDLXIYGJTUQTI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|