C11H14F2N2O2 — CID 47193946
1-(2,5-difluorophenyl)-3-(3-methoxypropyl)urea (PubChem CID 47193946) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(3-methoxypropyl)urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 47193946 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C11H14F2N2O2/c1-17-6-2-5-14-11(16)15-10-7-8(12)3-4-9(10)13/h3-4,7H,2,5-6H2,1H3,(H2,14,15,16) |
| InChIKey | MDPNAVOKXSYJOO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|