C12H14F2N2O2 — CID 63237113
1-(2-cyclopropyl-2-hydroxyethyl)-3-(2,4-difluorophenyl)urea (PubChem CID 63237113) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 1-(2-cyclopropyl-2-hydroxyethyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2-cyclopropyl-2-hydroxyethyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 63237113 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(2-cyclopropyl-2-hydroxyethyl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(NCC(O)C1CC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O2/c13-8-3-4-10(9(14)5-8)16-12(18)15-6-11(17)7-1-2-7/h3-5,7,11,17H,1-2,6H2,(H2,15,16,18) |
| InChIKey | HAXACRUGJHZGQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |