C11H8F2N2O2 — CID 108868619
1-(2,4-difluorophenyl)-3-(furan-2-yl)urea (PubChem CID 108868619) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(furan-2-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(furan-2-yl)urea |
|---|---|
| PubChem CID | 108868619 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(furan-2-yl)urea |
| SMILES | O=C(Nc1ccco1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H8F2N2O2/c12-7-3-4-9(8(13)6-7)14-11(16)15-10-2-1-5-17-10/h1-6H,(H2,14,15,16) |
| InChIKey | ONVCEJOUDGXBJS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |