C11H6Cl2F2N2OS — CID 2805628
1-(2,5-dichlorothiophen-3-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 2805628) has the molecular formula C11H6Cl2F2N2OS and a molecular weight of 323.15 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 2805628 |
| Molecular Formula | C11H6Cl2F2N2OS |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H6Cl2F2N2OS/c12-9-4-8(10(13)19-9)17-11(18)16-7-2-1-5(14)3-6(7)15/h1-4H,(H2,16,17,18) |
| InChIKey | IYIMZCOCHYOJGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |