C11H14F2N2O3 — CID 66168207
1-(2,4-difluorophenyl)-3-(2,3-dihydroxy-2-methylpropyl)urea (PubChem CID 66168207) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2,3-dihydroxy-2-methylpropyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2,3-dihydroxy-2-methylpropyl)urea |
|---|---|
| PubChem CID | 66168207 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2,3-dihydroxy-2-methylpropyl)urea |
| SMILES | CC(O)(CO)CNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2N2O3/c1-11(18,6-16)5-14-10(17)15-9-3-2-7(12)4-8(9)13/h2-4,16,18H,5-6H2,1H3,(H2,14,15,17) |
| InChIKey | PGIQEZVCZWNIBR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |