C13H17FN2O4 — CID 66002794
4-[(2-fluoro-4-methylphenyl)carbamoylamino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 66002794) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 4-[(2-fluoro-4-methylphenyl)carbamoylamino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[(2-fluoro-4-methylphenyl)carbamoylamino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002794 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[(2-fluoro-4-methylphenyl)carbamoylamino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | Cc1ccc(NC(=O)NCC(C)(O)CC(=O)O)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O4/c1-8-3-4-10(9(14)5-8)16-12(19)15-7-13(2,20)6-11(17)18/h3-5,20H,6-7H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | OXDMRGNIPXXIJH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |