C14H20F2N2O2 — CID 66179176
1-(2,4-difluorophenyl)-3-(2-hydroxy-2,4-dimethylpentyl)urea (PubChem CID 66179176) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,4-dimethylpentyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 66179176 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,4-dimethylpentyl)urea |
| SMILES | CC(C)CC(C)(O)CNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-9(2)7-14(3,20)8-17-13(19)18-12-5-4-10(15)6-11(12)16/h4-6,9,20H,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | PQLVVRMTBMQCSX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |