C13H18BrFN2O2 — CID 111472928
1-(4-bromo-2-fluorophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea (PubChem CID 111472928) has the molecular formula C13H18BrFN2O2 and a molecular weight of 333.20 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111472928 |
| Molecular Formula | C13H18BrFN2O2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(4-hydroxy-2,2-dimethylbutyl)urea |
| SMILES | CC(C)(CCO)CNC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H18BrFN2O2/c1-13(2,5-6-18)8-16-12(19)17-11-4-3-9(14)7-10(11)15/h3-4,7,18H,5-6,8H2,1-2H3,(H2,16,17,19) |
| InChIKey | IEONHBJAYUDPCZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |